Table III.

Inhibition of [3H]RH-4032 binding in tobacco suspension-cultured cells and inhibition of tobacco root elongation by various N-phenylcarbamates

Table III.
Compound2345RRoot InhibitionBinding Assay
EC50IC50
μm
ChlorbufamHClHH-CH(CH3)CCH1.1818.6
ChlorprophamHClHH-isopropyl0.7529.8
AHClHH-CH2CCCH2CH3 0.9939.2
BarbanHClHH-CH2CCCH2Cl1.0447.9
BHClHCl-isopropyl14.481.8
CHClClH-isopropyl117.1116
DHClHCl-CH3 34.5199
EClClHH-isopropyl>200>200
FClHClCl-isopropyl>200>200
GHClCH3H-ispropyl>200>200